C13H12BrF4NO — CID 168505060
4-(bromomethyl)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 168505060) has the molecular formula C13H12BrF4NO and a molecular weight of 354.14 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168505060 |
| Molecular Formula | C13H12BrF4NO |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 4-(bromomethyl)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1Cc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H12BrF4NO/c14-5-8-3-12(20)19(6-8)7-9-1-2-10(15)4-11(9)13(16,17)18/h1-2,4,8H,3,5-7H2 |
| InChIKey | HTNNUZKDXSICMA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|