C15H16BrNO2 — CID 168505492
4-(bromomethyl)-1-(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrrolidin-2-one (PubChem CID 168505492) has the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168505492 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-(bromomethyl)-1-(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CCCc2cc(N3CC(CBr)CC3=O)ccc21 |
| InChI | InChI=1S/C15H16BrNO2/c16-8-10-6-15(19)17(9-10)12-4-5-13-11(7-12)2-1-3-14(13)18/h4-5,7,10H,1-3,6,8-9H2 |
| InChIKey | JRPZHEXTYZZYJP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|