C15H18BrNO2 — CID 168503520
4-(bromomethyl)-1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidin-2-one (PubChem CID 168503520) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168503520 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-(bromomethyl)-1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1ccc2c(c1)C(O)CCC2 |
| InChI | InChI=1S/C15H18BrNO2/c16-8-10-6-15(19)17(9-10)12-5-4-11-2-1-3-14(18)13(11)7-12/h4-5,7,10,14,18H,1-3,6,8-9H2 |
| InChIKey | NQAPMCMDLXIOLR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|