C17H21NO3S — CID 168666185
S-[[1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666185) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is S-[[1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666185 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | S-[[1-(8-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2ccc3c(c2)C(O)CCC3)C1 |
| InChI | InChI=1S/C17H21NO3S/c1-11(19)22-10-12-7-17(21)18(9-12)14-6-5-13-3-2-4-16(20)15(13)8-14/h5-6,8,12,16,20H,2-4,7,9-10H2,1H3 |
| InChIKey | DNVJOHRSLVWLON-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|