C14H15BrN4O — CID 168506098
4-(bromomethyl)-1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidin-2-one (PubChem CID 168506098) has the molecular formula C14H15BrN4O and a molecular weight of 335.21 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506098 |
| Molecular Formula | C14H15BrN4O |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-(bromomethyl)-1-[4-(1,2,4-triazol-1-ylmethyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1ccc(Cn2cncn2)cc1 |
| InChI | InChI=1S/C14H15BrN4O/c15-6-12-5-14(20)19(8-12)13-3-1-11(2-4-13)7-18-10-16-9-17-18/h1-4,9-10,12H,5-8H2 |
| InChIKey | JGOXFJWJQGTXSD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|