C9H9ClIN3O2 — CID 168508145
2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 168508145) has the molecular formula C9H9ClIN3O2 and a molecular weight of 353.55 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168508145 |
| Molecular Formula | C9H9ClIN3O2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=C1CC(CCl)CN1c1ncc(I)c(=O)[nH]1 |
| InChI | InChI=1S/C9H9ClIN3O2/c10-2-5-1-7(15)14(4-5)9-12-3-6(11)8(16)13-9/h3,5H,1-2,4H2,(H,12,13,16) |
| InChIKey | YDQNDMLOIHPCGK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|