C9H11ClN4O2 — CID 168509386
2-amino-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 168509386) has the molecular formula C9H11ClN4O2 and a molecular weight of 242.67 g/mol. Its IUPAC name is 2-amino-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168509386 |
| Molecular Formula | C9H11ClN4O2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-amino-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N2CC(CCl)CC2=O)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H11ClN4O2/c10-3-5-1-8(16)14(4-5)6-2-7(15)13-9(11)12-6/h2,5H,1,3-4H2,(H3,11,12,13,15) |
| InChIKey | BOESWKDULDISOL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|