C11H10Cl2F3N — CID 168513028
1-[2,4-dichloro-3-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 168513028) has the molecular formula C11H10Cl2F3N and a molecular weight of 284.11 g/mol. Its IUPAC name is 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 168513028 |
| Molecular Formula | C11H10Cl2F3N |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | FC(F)(F)c1c(Cl)ccc(N2CCCC2)c1Cl |
| InChI | InChI=1S/C11H10Cl2F3N/c12-7-3-4-8(17-5-1-2-6-17)10(13)9(7)11(14,15)16/h3-4H,1-2,5-6H2 |
| InChIKey | GUGCJSCCNUXUHR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |