C9H10Cl2N2 — CID 87606916
2,3-dichloro-4-pyrrolidin-1-ylpyridine (PubChem CID 87606916) has the molecular formula C9H10Cl2N2 and a molecular weight of 217.10 g/mol. Its IUPAC name is 2,3-dichloro-4-pyrrolidin-1-ylpyridine.
| Compound Name | 2,3-dichloro-4-pyrrolidin-1-ylpyridine |
|---|---|
| PubChem CID | 87606916 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 2,3-dichloro-4-pyrrolidin-1-ylpyridine |
| SMILES | Clc1nccc(N2CCCC2)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2/c10-8-7(3-4-12-9(8)11)13-5-1-2-6-13/h3-4H,1-2,5-6H2 |
| InChIKey | WMACXVBPPVMDQW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|