C17H20N2O — CID 168514926
2-methyl-5-(2-methyl-4-pyrrolidin-1-ylphenoxy)pyridine (PubChem CID 168514926) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-methyl-5-(2-methyl-4-pyrrolidin-1-ylphenoxy)pyridine.
| Compound Name | 2-methyl-5-(2-methyl-4-pyrrolidin-1-ylphenoxy)pyridine |
|---|---|
| PubChem CID | 168514926 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-methyl-5-(2-methyl-4-pyrrolidin-1-ylphenoxy)pyridine |
| SMILES | Cc1ccc(Oc2ccc(N3CCCC3)cc2C)cn1 |
| InChI | InChI=1S/C17H20N2O/c1-13-11-15(19-9-3-4-10-19)6-8-17(13)20-16-7-5-14(2)18-12-16/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | VROHWOCRLNRSSQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |