C23H23N3O — CID 141132078
3-[2-(2,5-dihydropyrrol-1-yl)-4-methyl-5-[(6-methyl-3-pyridinyl)oxy]phenyl]aniline (PubChem CID 141132078) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-[2-(2,5-dihydropyrrol-1-yl)-4-methyl-5-[(6-methyl-3-pyridinyl)oxy]phenyl]aniline.
| Compound Name | 3-[2-(2,5-dihydropyrrol-1-yl)-4-methyl-5-[(6-methyl-3-pyridinyl)oxy]phenyl]aniline |
|---|---|
| PubChem CID | 141132078 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-[2-(2,5-dihydropyrrol-1-yl)-4-methyl-5-[(6-methyl-3-pyridinyl)oxy]phenyl]aniline |
| SMILES | Cc1ccc(Oc2cc(-c3cccc(N)c3)c(N3CC=CC3)cc2C)cn1 |
| InChI | InChI=1S/C23H23N3O/c1-16-12-22(26-10-3-4-11-26)21(18-6-5-7-19(24)13-18)14-23(16)27-20-9-8-17(2)25-15-20/h3-9,12-15H,10-11,24H2,1-2H3 |
| InChIKey | ZURUNVBXHJISJY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|