C18H20ClNO — CID 168515010
1-[3-chloro-4-(2,5-dimethylphenoxy)phenyl]pyrrolidine (PubChem CID 168515010) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 1-[3-chloro-4-(2,5-dimethylphenoxy)phenyl]pyrrolidine.
| Compound Name | 1-[3-chloro-4-(2,5-dimethylphenoxy)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 168515010 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[3-chloro-4-(2,5-dimethylphenoxy)phenyl]pyrrolidine |
| SMILES | Cc1ccc(C)c(Oc2ccc(N3CCCC3)cc2Cl)c1 |
| InChI | InChI=1S/C18H20ClNO/c1-13-5-6-14(2)18(11-13)21-17-8-7-15(12-16(17)19)20-9-3-4-10-20/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | VZTVOWGRSHCHRT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |