C15H12ClNO2 — CID 169355091
2-chloro-1-(2,5-dimethylphenoxy)-4-isocyanatobenzene (PubChem CID 169355091) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-chloro-1-(2,5-dimethylphenoxy)-4-isocyanatobenzene.
| Compound Name | 2-chloro-1-(2,5-dimethylphenoxy)-4-isocyanatobenzene |
|---|---|
| PubChem CID | 169355091 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-chloro-1-(2,5-dimethylphenoxy)-4-isocyanatobenzene |
| SMILES | Cc1ccc(C)c(Oc2ccc(N=C=O)cc2Cl)c1 |
| InChI | InChI=1S/C15H12ClNO2/c1-10-3-4-11(2)15(7-10)19-14-6-5-12(17-9-18)8-13(14)16/h3-8H,1-2H3 |
| InChIKey | DCWFHNMUTVUWHP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|