C23H18N2O4 — CID 158816066
2,4-bis(3-isocyanato-5-methylphenoxy)-1-methylbenzene (PubChem CID 158816066) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2,4-bis(3-isocyanato-5-methylphenoxy)-1-methylbenzene.
| Compound Name | 2,4-bis(3-isocyanato-5-methylphenoxy)-1-methylbenzene |
|---|---|
| PubChem CID | 158816066 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2,4-bis(3-isocyanato-5-methylphenoxy)-1-methylbenzene |
| SMILES | Cc1cc(N=C=O)cc(Oc2ccc(C)c(Oc3cc(C)cc(N=C=O)c3)c2)c1 |
| InChI | InChI=1S/C23H18N2O4/c1-15-6-18(24-13-26)10-21(8-15)28-20-5-4-17(3)23(12-20)29-22-9-16(2)7-19(11-22)25-14-27/h4-12H,1-3H3 |
| InChIKey | IVGXYYKWTMKXQW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|