C13H13Cl2N3 — CID 168515848
4,5-dichloro-1-(4-pyrrolidin-1-ylphenyl)imidazole (PubChem CID 168515848) has the molecular formula C13H13Cl2N3 and a molecular weight of 282.17 g/mol. Its IUPAC name is 4,5-dichloro-1-(4-pyrrolidin-1-ylphenyl)imidazole.
| Compound Name | 4,5-dichloro-1-(4-pyrrolidin-1-ylphenyl)imidazole |
|---|---|
| PubChem CID | 168515848 |
| Molecular Formula | C13H13Cl2N3 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4,5-dichloro-1-(4-pyrrolidin-1-ylphenyl)imidazole |
| SMILES | Clc1ncn(-c2ccc(N3CCCC3)cc2)c1Cl |
| InChI | InChI=1S/C13H13Cl2N3/c14-12-13(15)18(9-16-12)11-5-3-10(4-6-11)17-7-1-2-8-17/h3-6,9H,1-2,7-8H2 |
| InChIKey | LRQMUKJIOIEANG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|