C23H24N4O5S2 — CID 16851760
4-(azepan-1-ylsulfonyl)-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 16851760) has the molecular formula C23H24N4O5S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 16851760 |
| Molecular Formula | C23H24N4O5S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C23H24N4O5S2/c1-2-13-26-20-16-18(27(29)30)9-12-21(20)33-23(26)24-22(28)17-7-10-19(11-8-17)34(31,32)25-14-5-3-4-6-15-25/h2,7-12,16H,1,3-6,13-15H2/b24-23- |
| InChIKey | ZLLWDAYSLFKNJN-VHXPQNKSSA-N |
| XLogP | 4.10 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|