C15H8FN5O2 — CID 168518069
2-[5-fluoro-2-(tetrazol-1-yl)phenyl]isoindole-1,3-dione (PubChem CID 168518069) has the molecular formula C15H8FN5O2 and a molecular weight of 309.26 g/mol. Its IUPAC name is 2-[5-fluoro-2-(tetrazol-1-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[5-fluoro-2-(tetrazol-1-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518069 |
| Molecular Formula | C15H8FN5O2 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[5-fluoro-2-(tetrazol-1-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(F)ccc1-n1cnnn1 |
| InChI | InChI=1S/C15H8FN5O2/c16-9-5-6-12(20-8-17-18-19-20)13(7-9)21-14(22)10-3-1-2-4-11(10)15(21)23/h1-8H |
| InChIKey | YAJRPHBMRBVXBH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|