C19H14FN3O3 — CID 168519285
2-[5-fluoro-2-[(1-methylpyrazol-3-yl)methoxy]phenyl]isoindole-1,3-dione (PubChem CID 168519285) has the molecular formula C19H14FN3O3 and a molecular weight of 351.34 g/mol. Its IUPAC name is 2-[5-fluoro-2-[(1-methylpyrazol-3-yl)methoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[5-fluoro-2-[(1-methylpyrazol-3-yl)methoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519285 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[5-fluoro-2-[(1-methylpyrazol-3-yl)methoxy]phenyl]isoindole-1,3-dione |
| SMILES | Cn1ccc(COc2ccc(F)cc2N2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C19H14FN3O3/c1-22-9-8-13(21-22)11-26-17-7-6-12(20)10-16(17)23-18(24)14-4-2-3-5-15(14)19(23)25/h2-10H,11H2,1H3 |
| InChIKey | QGYVUXKJGOOUJY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|