C12H13N3O3 — CID 168521072
3-[(2-cyanoacetyl)amino]-4-methoxy-N-methylbenzamide (PubChem CID 168521072) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-[(2-cyanoacetyl)amino]-4-methoxy-N-methylbenzamide.
| Compound Name | 3-[(2-cyanoacetyl)amino]-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 168521072 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-[(2-cyanoacetyl)amino]-4-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(OC)c(NC(=O)CC#N)c1 |
| InChI | InChI=1S/C12H13N3O3/c1-14-12(17)8-3-4-10(18-2)9(7-8)15-11(16)5-6-13/h3-4,7H,5H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | ITHIQYJQLMRNEM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |