C12H12N2O5 — CID 168521900
methyl 3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methoxybenzoate (PubChem CID 168521900) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is methyl 3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methoxybenzoate.
| Compound Name | methyl 3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 168521900 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(OC)cc(NC(=O)CC#N)c1O |
| InChI | InChI=1S/C12H12N2O5/c1-18-7-5-8(12(17)19-2)11(16)9(6-7)14-10(15)3-4-13/h5-6,16H,3H2,1-2H3,(H,14,15) |
| InChIKey | RTSJZNYVIDFFPN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|