C15H19N3O3S — CID 168523033
2-cyano-N-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]acetamide (PubChem CID 168523033) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-cyano-N-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | 2-cyano-N-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 168523033 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-cyano-N-[3-(4-methylpiperidin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(NC(=O)CC#N)c2)CC1 |
| InChI | InChI=1S/C15H19N3O3S/c1-12-6-9-18(10-7-12)22(20,21)14-4-2-3-13(11-14)17-15(19)5-8-16/h2-4,11-12H,5-7,9-10H2,1H3,(H,17,19) |
| InChIKey | NOCOHPXUWSFALU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |