C10H6F2O2 — CID 168525979
2,3-difluoro-5-(furan-2-yl)phenol (PubChem CID 168525979) has the molecular formula C10H6F2O2 and a molecular weight of 196.15 g/mol. Its IUPAC name is 2,3-difluoro-5-(furan-2-yl)phenol.
| Compound Name | 2,3-difluoro-5-(furan-2-yl)phenol |
|---|---|
| PubChem CID | 168525979 |
| Molecular Formula | C10H6F2O2 |
| Molecular Weight | 196.15 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2,3-difluoro-5-(furan-2-yl)phenol |
| SMILES | Oc1cc(-c2ccco2)cc(F)c1F |
| InChI | InChI=1S/C10H6F2O2/c11-7-4-6(5-8(13)10(7)12)9-2-1-3-14-9/h1-5,13H |
| InChIKey | IGPCSCGEDPXAFL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |