About 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan
2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan (PubChem CID 168528467) has the molecular formula C17H7F7O2
and a molecular weight of 376.23 g/mol. Its IUPAC name is 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan.
Molecular Properties
| Compound Name | 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan |
| PubChem CID | 168528467 |
| Molecular Formula | C17H7F7O2 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan |
| SMILES | Fc1cc(-c2ccco2)cc(F)c1Oc1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C17H7F7O2/c18-10-4-8(14-2-1-3-25-14)5-11(19)15(10)26-16-12(20)6-9(7-13(16)21)17(22,23)24/h1-7H |
| InChIKey | QYKZHMJBNQHHPG-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan?
The IUPAC name of 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan (CID 168528467) is 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan.
What is the SMILES notation for 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan?
The canonical SMILES for 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan is Fc1cc(-c2ccco2)cc(F)c1Oc1c(F)cc(C(F)(F)F)cc1F.
What is the InChIKey of 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan?
The InChIKey is QYKZHMJBNQHHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H7F7O2/c18-10-4-8(14-2-1-3-25-14)5-11(19)15(10)26-16-12(20)6-9(7-13(16)21)17(22,23)24/h1-7H.
What are the key properties of 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan?
2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan has a molecular weight of 376.23 g/mol, XLogP of 6.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-3,5-difluorophenyl]furan is sourced from PubChem (CID 168528467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).