C15H15NO2 — CID 168527165
6-(furan-2-yl)-1,1-dimethyl-2,4-dihydroisoquinolin-3-one (PubChem CID 168527165) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 6-(furan-2-yl)-1,1-dimethyl-2,4-dihydroisoquinolin-3-one.
| Compound Name | 6-(furan-2-yl)-1,1-dimethyl-2,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 168527165 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-(furan-2-yl)-1,1-dimethyl-2,4-dihydroisoquinolin-3-one |
| SMILES | CC1(C)NC(=O)Cc2cc(-c3ccco3)ccc21 |
| InChI | InChI=1S/C15H15NO2/c1-15(2)12-6-5-10(13-4-3-7-18-13)8-11(12)9-14(17)16-15/h3-8H,9H2,1-2H3,(H,16,17) |
| InChIKey | HKOAJKHRLJLSTR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |