C14H11F3N2O — CID 168529513
[2-[(3,5-difluorophenyl)methoxy]-4-fluorophenyl]methylidenehydrazine (PubChem CID 168529513) has the molecular formula C14H11F3N2O and a molecular weight of 280.25 g/mol. Its IUPAC name is [2-[(3,5-difluorophenyl)methoxy]-4-fluorophenyl]methylidenehydrazine.
| Compound Name | [2-[(3,5-difluorophenyl)methoxy]-4-fluorophenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 168529513 |
| Molecular Formula | C14H11F3N2O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [2-[(3,5-difluorophenyl)methoxy]-4-fluorophenyl]methylidenehydrazine |
| SMILES | NN=Cc1ccc(F)cc1OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H11F3N2O/c15-11-2-1-10(7-19-18)14(6-11)20-8-9-3-12(16)5-13(17)4-9/h1-7H,8,18H2 |
| InChIKey | UFNQALVCMDWYLA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|