C14H11Cl2N3O2 — CID 168533783
[[3-(3,4-dichlorophenoxy)phenyl]methylideneamino]urea (PubChem CID 168533783) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is [[3-(3,4-dichlorophenoxy)phenyl]methylideneamino]urea.
| Compound Name | [[3-(3,4-dichlorophenoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533783 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | [[3-(3,4-dichlorophenoxy)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1cccc(Oc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c15-12-5-4-11(7-13(12)16)21-10-3-1-2-9(6-10)8-18-19-14(17)20/h1-8H,(H3,17,19,20) |
| InChIKey | WCZZUSQRGYXLBV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|