C14H11FN2O4 — CID 168536847
3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-fluorobenzonitrile (PubChem CID 168536847) has the molecular formula C14H11FN2O4 and a molecular weight of 290.25 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-fluorobenzonitrile.
| Compound Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 168536847 |
| Molecular Formula | C14H11FN2O4 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-5-fluorobenzonitrile |
| SMILES | CC1(C)OC(=O)C(=CNc2cc(F)cc(C#N)c2)C(=O)O1 |
| InChI | InChI=1S/C14H11FN2O4/c1-14(2)20-12(18)11(13(19)21-14)7-17-10-4-8(6-16)3-9(15)5-10/h3-5,7,17H,1-2H3 |
| InChIKey | MQHPMLKWGNEAKW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|