C31H28N2O8 — CID 168536964
3-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 168536964) has the molecular formula C31H28N2O8 and a molecular weight of 556.57 g/mol. Its IUPAC name is 3-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 168536964 |
| Molecular Formula | C31H28N2O8 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 3-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)cc2)C(=O)O1 |
| InChI | InChI=1S/C31H28N2O8/c1-31(2)40-28(36)24(29(37)41-31)16-32-19-13-11-18(12-14-19)15-26(27(34)35)33-30(38)39-17-25-22-9-5-3-7-20(22)21-8-4-6-10-23(21)25/h3-14,16,25-26,32H,15,17H2,1-2H3,(H,33,38)(H,34,35) |
| InChIKey | DHBXVELBVBKZDD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|