C17H18N2O6 — CID 168537495
5-[[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168537495) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 5-[[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168537495 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 5-[[(2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1Oc2ccc(NC=C3C(=O)OC(C)(C)OC3=O)cc2N(C)C1=O |
| InChI | InChI=1S/C17H18N2O6/c1-9-14(20)19(4)12-7-10(5-6-13(12)23-9)18-8-11-15(21)24-17(2,3)25-16(11)22/h5-9,18H,1-4H3 |
| InChIKey | IASLPWYHNVPWOE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|