C14H13N3O5 — CID 168537768
2,2-dimethyl-5-[[(3-oxo-1,2-dihydroindazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168537768) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[(3-oxo-1,2-dihydroindazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[(3-oxo-1,2-dihydroindazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168537768 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2,2-dimethyl-5-[[(3-oxo-1,2-dihydroindazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc3[nH][nH]c(=O)c3c2)C(=O)O1 |
| InChI | InChI=1S/C14H13N3O5/c1-14(2)21-12(19)9(13(20)22-14)6-15-7-3-4-10-8(5-7)11(18)17-16-10/h3-6,15H,1-2H3,(H2,16,17,18) |
| InChIKey | GOIGJQRORDVVPJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|