C19H24N2O5 — CID 168537748
N-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methylphenyl]-3-methylbutanamide (PubChem CID 168537748) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methylphenyl]-3-methylbutanamide.
| Compound Name | N-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methylphenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 168537748 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-4-methylphenyl]-3-methylbutanamide |
| SMILES | Cc1ccc(NC(=O)CC(C)C)cc1NC=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C19H24N2O5/c1-11(2)8-16(22)21-13-7-6-12(3)15(9-13)20-10-14-17(23)25-19(4,5)26-18(14)24/h6-7,9-11,20H,8H2,1-5H3,(H,21,22) |
| InChIKey | VHTOAJOVILSAGG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|