C14H11F2NO5 — CID 168540540
2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4-difluorobenzaldehyde (PubChem CID 168540540) has the molecular formula C14H11F2NO5 and a molecular weight of 311.24 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4-difluorobenzaldehyde.
| Compound Name | 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4-difluorobenzaldehyde |
|---|---|
| PubChem CID | 168540540 |
| Molecular Formula | C14H11F2NO5 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]-3,4-difluorobenzaldehyde |
| SMILES | CC1(C)OC(=O)C(=CNc2c(C=O)ccc(F)c2F)C(=O)O1 |
| InChI | InChI=1S/C14H11F2NO5/c1-14(2)21-12(19)8(13(20)22-14)5-17-11-7(6-18)3-4-9(15)10(11)16/h3-6,17H,1-2H3 |
| InChIKey | VDJDXGIGFIWXFM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|