C14H10BrN5 — CID 168543532
2-[[3-[(4-bromopyrazol-1-yl)methyl]anilino]methylidene]propanedinitrile (PubChem CID 168543532) has the molecular formula C14H10BrN5 and a molecular weight of 328.17 g/mol. Its IUPAC name is 2-[[3-[(4-bromopyrazol-1-yl)methyl]anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-[(4-bromopyrazol-1-yl)methyl]anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543532 |
| Molecular Formula | C14H10BrN5 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-[[3-[(4-bromopyrazol-1-yl)methyl]anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cccc(Cn2cc(Br)cn2)c1 |
| InChI | InChI=1S/C14H10BrN5/c15-13-8-19-20(10-13)9-11-2-1-3-14(4-11)18-7-12(5-16)6-17/h1-4,7-8,10,18H,9H2 |
| InChIKey | GIVKGQPLBPUAOJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|