C13H15BrClN3O — CID 168638839
1-[3-[(4-bromopyrazol-1-yl)methyl]anilino]-3-chloropropan-2-ol (PubChem CID 168638839) has the molecular formula C13H15BrClN3O and a molecular weight of 344.64 g/mol. Its IUPAC name is 1-[3-[(4-bromopyrazol-1-yl)methyl]anilino]-3-chloropropan-2-ol.
| Compound Name | 1-[3-[(4-bromopyrazol-1-yl)methyl]anilino]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 168638839 |
| Molecular Formula | C13H15BrClN3O |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 1-[3-[(4-bromopyrazol-1-yl)methyl]anilino]-3-chloropropan-2-ol |
| SMILES | OC(CCl)CNc1cccc(Cn2cc(Br)cn2)c1 |
| InChI | InChI=1S/C13H15BrClN3O/c14-11-6-17-18(9-11)8-10-2-1-3-12(4-10)16-7-13(19)5-15/h1-4,6,9,13,16,19H,5,7-8H2 |
| InChIKey | KSJNJJXEWFJWHG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|