C11H7Br2N3O2S — CID 168544135
2-[(2,6-dibromo-4-methylsulfonylanilino)methylidene]propanedinitrile (PubChem CID 168544135) has the molecular formula C11H7Br2N3O2S and a molecular weight of 405.07 g/mol. Its IUPAC name is 2-[(2,6-dibromo-4-methylsulfonylanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(2,6-dibromo-4-methylsulfonylanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544135 |
| Molecular Formula | C11H7Br2N3O2S |
| Molecular Weight | 405.07 g/mol |
| Exact Mass | 402.86 |
| IUPAC Name | 2-[(2,6-dibromo-4-methylsulfonylanilino)methylidene]propanedinitrile |
| SMILES | CS(=O)(=O)c1cc(Br)c(NC=C(C#N)C#N)c(Br)c1 |
| InChI | InChI=1S/C11H7Br2N3O2S/c1-19(17,18)8-2-9(12)11(10(13)3-8)16-6-7(4-14)5-15/h2-3,6,16H,1H3 |
| InChIKey | BSONOSFHKADVPV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.07 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|