C11H4Br2F3N3 — CID 168511705
2-[[2,4-dibromo-6-(trifluoromethyl)anilino]methylidene]propanedinitrile (PubChem CID 168511705) has the molecular formula C11H4Br2F3N3 and a molecular weight of 394.98 g/mol. Its IUPAC name is 2-[[2,4-dibromo-6-(trifluoromethyl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[2,4-dibromo-6-(trifluoromethyl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168511705 |
| Molecular Formula | C11H4Br2F3N3 |
| Molecular Weight | 394.98 g/mol |
| Exact Mass | 392.87 |
| IUPAC Name | 2-[[2,4-dibromo-6-(trifluoromethyl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1c(Br)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H4Br2F3N3/c12-7-1-8(11(14,15)16)10(9(13)2-7)19-5-6(3-17)4-18/h1-2,5,19H |
| InChIKey | WUAHVBSSYNOGMT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|