C17H13N5O — CID 168544607
2-(2,2-dicyanoethenylamino)-N-(6-methyl-2-pyridinyl)benzamide (PubChem CID 168544607) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-(2,2-dicyanoethenylamino)-N-(6-methyl-2-pyridinyl)benzamide.
| Compound Name | 2-(2,2-dicyanoethenylamino)-N-(6-methyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 168544607 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(2,2-dicyanoethenylamino)-N-(6-methyl-2-pyridinyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC=C(C#N)C#N)n1 |
| InChI | InChI=1S/C17H13N5O/c1-12-5-4-8-16(21-12)22-17(23)14-6-2-3-7-15(14)20-11-13(9-18)10-19/h2-8,11,20H,1H3,(H,21,22,23) |
| InChIKey | RIBKBQYFJFGIPA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|