C20H20N2O5 — CID 168550872
ethyl 4-[3-hydroxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]butanoate (PubChem CID 168550872) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 4-[3-hydroxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]butanoate.
| Compound Name | ethyl 4-[3-hydroxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 168550872 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 4-[3-hydroxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(-c2nc3ccccc3c(=O)[nH]2)c(O)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-2-26-18(24)8-5-11-27-13-9-10-15(17(23)12-13)19-21-16-7-4-3-6-14(16)20(25)22-19/h3-4,6-7,9-10,12,23H,2,5,8,11H2,1H3,(H,21,22,25) |
| InChIKey | NFBRCUFJXDCHKU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|