C19H18F2N2O2 — CID 168551082
2-[3,5-difluoro-2-(3-methylbutoxy)phenyl]-3H-quinazolin-4-one (PubChem CID 168551082) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[3,5-difluoro-2-(3-methylbutoxy)phenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[3,5-difluoro-2-(3-methylbutoxy)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168551082 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[3,5-difluoro-2-(3-methylbutoxy)phenyl]-3H-quinazolin-4-one |
| SMILES | CC(C)CCOc1c(F)cc(F)cc1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H18F2N2O2/c1-11(2)7-8-25-17-14(9-12(20)10-15(17)21)18-22-16-6-4-3-5-13(16)19(24)23-18/h3-6,9-11H,7-8H2,1-2H3,(H,22,23,24) |
| InChIKey | KHADCLFECWQVDX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |