C22H16N2O3 — CID 168551369
2-[3-[4-(4-oxo-3H-quinazolin-2-yl)phenyl]phenyl]acetic acid (PubChem CID 168551369) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[3-[4-(4-oxo-3H-quinazolin-2-yl)phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-[4-(4-oxo-3H-quinazolin-2-yl)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 168551369 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[3-[4-(4-oxo-3H-quinazolin-2-yl)phenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(-c2ccc(-c3nc4ccccc4c(=O)[nH]3)cc2)c1 |
| InChI | InChI=1S/C22H16N2O3/c25-20(26)13-14-4-3-5-17(12-14)15-8-10-16(11-9-15)21-23-19-7-2-1-6-18(19)22(27)24-21/h1-12H,13H2,(H,25,26)(H,23,24,27) |
| InChIKey | FFJGBQXBKNGGBG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |