C16H10Br2N2O4 — CID 168553022
2-[2,6-dibromo-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetic acid (PubChem CID 168553022) has the molecular formula C16H10Br2N2O4 and a molecular weight of 454.07 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 168553022 |
| Molecular Formula | C16H10Br2N2O4 |
| Molecular Weight | 454.07 g/mol |
| Exact Mass | 451.90 |
| IUPAC Name | 2-[2,6-dibromo-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(-c2nc3ccccc3c(=O)[nH]2)cc1Br |
| InChI | InChI=1S/C16H10Br2N2O4/c17-10-5-8(6-11(18)14(10)24-7-13(21)22)15-19-12-4-2-1-3-9(12)16(23)20-15/h1-6H,7H2,(H,21,22)(H,19,20,23) |
| InChIKey | OEKUZPCVIJBMCV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.07 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |