C14H8Br2N2O2 — CID 135579414
2-(3,5-dibromo-2-hydroxyphenyl)-3H-quinazolin-4-one (PubChem CID 135579414) has the molecular formula C14H8Br2N2O2 and a molecular weight of 396.04 g/mol. Its IUPAC name is 2-(3,5-dibromo-2-hydroxyphenyl)-3H-quinazolin-4-one.
| Compound Name | 2-(3,5-dibromo-2-hydroxyphenyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135579414 |
| Molecular Formula | C14H8Br2N2O2 |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | 2-(3,5-dibromo-2-hydroxyphenyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2cc(Br)cc(Br)c2O)nc2ccccc12 |
| InChI | InChI=1S/C14H8Br2N2O2/c15-7-5-9(12(19)10(16)6-7)13-17-11-4-2-1-3-8(11)14(20)18-13/h1-6,19H,(H,17,18,20) |
| InChIKey | UZFLRKAIHSICRL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |