C17H14BrN3O2S — CID 168552696
S-[5-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 168552696) has the molecular formula C17H14BrN3O2S and a molecular weight of 404.29 g/mol. Its IUPAC name is S-[5-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[5-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 168552696 |
| Molecular Formula | C17H14BrN3O2S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | S-[5-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1cc(Br)ccc1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H14BrN3O2S/c1-21(2)17(23)24-14-9-10(18)7-8-12(14)15-19-13-6-4-3-5-11(13)16(22)20-15/h3-9H,1-2H3,(H,19,20,22) |
| InChIKey | HVUFYIRMILSKIF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|