C20H18BrN3O2 — CID 168552414
6-[4-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenoxy]hexanenitrile (PubChem CID 168552414) has the molecular formula C20H18BrN3O2 and a molecular weight of 412.29 g/mol. Its IUPAC name is 6-[4-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenoxy]hexanenitrile.
| Compound Name | 6-[4-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenoxy]hexanenitrile |
|---|---|
| PubChem CID | 168552414 |
| Molecular Formula | C20H18BrN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 6-[4-bromo-2-(4-oxo-3H-quinazolin-2-yl)phenoxy]hexanenitrile |
| SMILES | N#CCCCCCOc1ccc(Br)cc1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H18BrN3O2/c21-14-9-10-18(26-12-6-2-1-5-11-22)16(13-14)19-23-17-8-4-3-7-15(17)20(25)24-19/h3-4,7-10,13H,1-2,5-6,12H2,(H,23,24,25) |
| InChIKey | ZMUBJYUBYRUURQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|