C17H12BrIN2O2 — CID 168552575
2-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-3H-quinazolin-4-one (PubChem CID 168552575) has the molecular formula C17H12BrIN2O2 and a molecular weight of 483.10 g/mol. Its IUPAC name is 2-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-3H-quinazolin-4-one.
| Compound Name | 2-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552575 |
| Molecular Formula | C17H12BrIN2O2 |
| Molecular Weight | 483.10 g/mol |
| Exact Mass | 481.91 |
| IUPAC Name | 2-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-3H-quinazolin-4-one |
| SMILES | C=CCOc1c(I)cc(Br)cc1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H12BrIN2O2/c1-2-7-23-15-12(8-10(18)9-13(15)19)16-20-14-6-4-3-5-11(14)17(22)21-16/h2-6,8-9H,1,7H2,(H,20,21,22) |
| InChIKey | OVLGLLIWQWLRAV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.10 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|