C15H10N4OS — CID 168552705
2-(2-amino-1,3-benzothiazol-6-yl)-3H-quinazolin-4-one (PubChem CID 168552705) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-(2-amino-1,3-benzothiazol-6-yl)-3H-quinazolin-4-one.
| Compound Name | 2-(2-amino-1,3-benzothiazol-6-yl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552705 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(2-amino-1,3-benzothiazol-6-yl)-3H-quinazolin-4-one |
| SMILES | Nc1nc2ccc(-c3nc4ccccc4c(=O)[nH]3)cc2s1 |
| InChI | InChI=1S/C15H10N4OS/c16-15-18-11-6-5-8(7-12(11)21-15)13-17-10-4-2-1-3-9(10)14(20)19-13/h1-7H,(H2,16,18)(H,17,19,20) |
| InChIKey | OQJVPZHDOAOLEA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |