C14H8Cl2N4S — CID 82005407
6-(5,6-dichloro-1H-benzimidazol-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 82005407) has the molecular formula C14H8Cl2N4S and a molecular weight of 335.22 g/mol. Its IUPAC name is 6-(5,6-dichloro-1H-benzimidazol-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(5,6-dichloro-1H-benzimidazol-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82005407 |
| Molecular Formula | C14H8Cl2N4S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 6-(5,6-dichloro-1H-benzimidazol-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(-c3nc4cc(Cl)c(Cl)cc4[nH]3)cc2s1 |
| InChI | InChI=1S/C14H8Cl2N4S/c15-7-4-10-11(5-8(7)16)19-13(18-10)6-1-2-9-12(3-6)21-14(17)20-9/h1-5H,(H2,17,20)(H,18,19) |
| InChIKey | ILFAPLXKUOHVCN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |