C13H8Cl3N3 — CID 82001058
3-chloro-2-(5,6-dichloro-1H-benzimidazol-2-yl)aniline (PubChem CID 82001058) has the molecular formula C13H8Cl3N3 and a molecular weight of 312.59 g/mol. Its IUPAC name is 3-chloro-2-(5,6-dichloro-1H-benzimidazol-2-yl)aniline.
| Compound Name | 3-chloro-2-(5,6-dichloro-1H-benzimidazol-2-yl)aniline |
|---|---|
| PubChem CID | 82001058 |
| Molecular Formula | C13H8Cl3N3 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 3-chloro-2-(5,6-dichloro-1H-benzimidazol-2-yl)aniline |
| SMILES | Nc1cccc(Cl)c1-c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C13H8Cl3N3/c14-6-2-1-3-9(17)12(6)13-18-10-4-7(15)8(16)5-11(10)19-13/h1-5H,17H2,(H,18,19) |
| InChIKey | VEGOVOPXHUATJG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|