C23H18N4O3 — CID 168552778
2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-3H-quinazolin-4-one (PubChem CID 168552778) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552778 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccc(N3CCc4ccccc4C3)c([N+](=O)[O-])c2)nc2ccccc12 |
| InChI | InChI=1S/C23H18N4O3/c28-23-18-7-3-4-8-19(18)24-22(25-23)16-9-10-20(21(13-16)27(29)30)26-12-11-15-5-1-2-6-17(15)14-26/h1-10,13H,11-12,14H2,(H,24,25,28) |
| InChIKey | XHZDNGRAPCGNIX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|