C16H10Cl2N2O3 — CID 168553239
[3,5-dichloro-4-(4-oxo-3H-quinazolin-2-yl)phenyl] acetate (PubChem CID 168553239) has the molecular formula C16H10Cl2N2O3 and a molecular weight of 349.17 g/mol. Its IUPAC name is [3,5-dichloro-4-(4-oxo-3H-quinazolin-2-yl)phenyl] acetate.
| Compound Name | [3,5-dichloro-4-(4-oxo-3H-quinazolin-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 168553239 |
| Molecular Formula | C16H10Cl2N2O3 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | [3,5-dichloro-4-(4-oxo-3H-quinazolin-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1cc(Cl)c(-c2nc3ccccc3c(=O)[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl2N2O3/c1-8(21)23-9-6-11(17)14(12(18)7-9)15-19-13-5-3-2-4-10(13)16(22)20-15/h2-7H,1H3,(H,19,20,22) |
| InChIKey | FLIZRJNGHHQLGG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|